C17H15F2NO4S — CID 76878493
N-[4-[3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]phenyl]methanesulfonamide (PubChem CID 76878493) has the molecular formula C17H15F2NO4S and a molecular weight of 367.37 g/mol. Its IUPAC name is N-[4-[3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 76878493 |
| Molecular Formula | C17H15F2NO4S |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N-[4-[3-[4-(difluoromethoxy)phenyl]prop-2-enoyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)C=Cc2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H15F2NO4S/c1-25(22,23)20-14-7-5-13(6-8-14)16(21)11-4-12-2-9-15(10-3-12)24-17(18)19/h2-11,17,20H,1H3 |
| InChIKey | DVIXIWSSMNLIOO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|