C18H20N4O — CID 166389046
3-(2,5-dimethyl-3-pyridinyl)-1-(1H-indol-2-ylmethyl)-1-methylurea (PubChem CID 166389046) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 3-(2,5-dimethyl-3-pyridinyl)-1-(1H-indol-2-ylmethyl)-1-methylurea.
| Compound Name | 3-(2,5-dimethyl-3-pyridinyl)-1-(1H-indol-2-ylmethyl)-1-methylurea |
|---|---|
| PubChem CID | 166389046 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-(2,5-dimethyl-3-pyridinyl)-1-(1H-indol-2-ylmethyl)-1-methylurea |
| SMILES | Cc1cnc(C)c(NC(=O)N(C)Cc2cc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C18H20N4O/c1-12-8-17(13(2)19-10-12)21-18(23)22(3)11-15-9-14-6-4-5-7-16(14)20-15/h4-10,20H,11H2,1-3H3,(H,21,23) |
| InChIKey | FKOYJPZWIZPSHM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |