About N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine
N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine (PubChem CID 16638962) has the molecular formula C9H11N5
and a molecular weight of 189.22 g/mol. Its IUPAC name is N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine |
| PubChem CID | 16638962 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine |
| SMILES | Cc1[nH]nc2c(NC3CC3)ncnc12 |
| InChI | InChI=1S/C9H11N5/c1-5-7-8(14-13-5)9(11-4-10-7)12-6-2-3-6/h4,6H,2-3H2,1H3,(H,13,14)(H,10,11,12) |
| InChIKey | CTRMXAARLMLINT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine?
The IUPAC name of N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine (CID 16638962) is N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine.
What is the SMILES notation for N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine?
The canonical SMILES for N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine is Cc1[nH]nc2c(NC3CC3)ncnc12.
What is the InChIKey of N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine?
The InChIKey is CTRMXAARLMLINT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5/c1-5-7-8(14-13-5)9(11-4-10-7)12-6-2-3-6/h4,6H,2-3H2,1H3,(H,13,14)(H,10,11,12).
What are the key properties of N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine?
N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine has a molecular weight of 189.22 g/mol, XLogP of 1.24, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-3-methyl-2H-pyrazolo[4,3-d]pyrimidin-7-amine is sourced from PubChem (CID 16638962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).