C12H14N4O — CID 166390708
N-(4-azidophenyl)-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 166390708) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is N-(4-azidophenyl)-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | N-(4-azidophenyl)-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 166390708 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N-(4-azidophenyl)-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)CC1C(=O)Nc1ccc(N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C12H14N4O/c1-12(2)7-10(12)11(17)14-8-3-5-9(6-4-8)15-16-13/h3-6,10H,7H2,1-2H3,(H,14,17) |
| InChIKey | BACUOHWIDQTBJR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|