C13H15N5O3 — CID 174200714
3-[(4-azidophenyl)carbamoyl]piperidine-1-carboxylic acid (PubChem CID 174200714) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is 3-[(4-azidophenyl)carbamoyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(4-azidophenyl)carbamoyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174200714 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-[(4-azidophenyl)carbamoyl]piperidine-1-carboxylic acid |
| SMILES | [N-]=[N+]=Nc1ccc(NC(=O)C2CCCN(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C13H15N5O3/c14-17-16-11-5-3-10(4-6-11)15-12(19)9-2-1-7-18(8-9)13(20)21/h3-6,9H,1-2,7-8H2,(H,15,19)(H,20,21) |
| InChIKey | QAYSHPOPKFUSNK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 118.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|