C20H22N2OS — CID 166391271
[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[2-(2-aminophenyl)sulfanylphenyl]methanone (PubChem CID 166391271) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is [(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[2-(2-aminophenyl)sulfanylphenyl]methanone.
| Compound Name | [(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[2-(2-aminophenyl)sulfanylphenyl]methanone |
|---|---|
| PubChem CID | 166391271 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-[2-(2-aminophenyl)sulfanylphenyl]methanone |
| SMILES | Nc1ccccc1Sc1ccccc1C(=O)N1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C20H22N2OS/c21-17-9-2-4-11-19(17)24-18-10-3-1-8-16(18)20(23)22-12-14-6-5-7-15(14)13-22/h1-4,8-11,14-15H,5-7,12-13,21H2/t14-,15+ |
| InChIKey | NTQWERCSLNXQMW-GASCZTMLSA-N |
| XLogP | 4.29 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|