C20H16F3N3O2 — CID 166394067
6-methyl-4-oxo-N-[2-[2-(trifluoromethyl)anilino]phenyl]-1H-pyridine-3-carboxamide (PubChem CID 166394067) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is 6-methyl-4-oxo-N-[2-[2-(trifluoromethyl)anilino]phenyl]-1H-pyridine-3-carboxamide.
| Compound Name | 6-methyl-4-oxo-N-[2-[2-(trifluoromethyl)anilino]phenyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166394067 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 6-methyl-4-oxo-N-[2-[2-(trifluoromethyl)anilino]phenyl]-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2ccccc2Nc2ccccc2C(F)(F)F)c[nH]1 |
| InChI | InChI=1S/C20H16F3N3O2/c1-12-10-18(27)13(11-24-12)19(28)26-17-9-5-4-8-16(17)25-15-7-3-2-6-14(15)20(21,22)23/h2-11,25H,1H3,(H,24,27)(H,26,28) |
| InChIKey | QCDCTTFFDZMKJZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |