C16H16N2O4S2 — CID 166396233
2-[[2-[2-(N-methylanilino)-2-oxoethyl]sulfanylacetyl]amino]thiophene-3-carboxylic acid (PubChem CID 166396233) has the molecular formula C16H16N2O4S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-[[2-[2-(N-methylanilino)-2-oxoethyl]sulfanylacetyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[2-[2-(N-methylanilino)-2-oxoethyl]sulfanylacetyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 166396233 |
| Molecular Formula | C16H16N2O4S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 2-[[2-[2-(N-methylanilino)-2-oxoethyl]sulfanylacetyl]amino]thiophene-3-carboxylic acid |
| SMILES | CN(C(=O)CSCC(=O)Nc1sccc1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O4S2/c1-18(11-5-3-2-4-6-11)14(20)10-23-9-13(19)17-15-12(16(21)22)7-8-24-15/h2-8H,9-10H2,1H3,(H,17,19)(H,21,22) |
| InChIKey | CVBIHBAWHQVEFR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |