C21H28N4O4 — CID 166396962
5-methoxy-3-methyl-N-[2-methyl-3-[methyl-(5-oxopyrrolidine-3-carbonyl)amino]propyl]-1H-indole-2-carboxamide (PubChem CID 166396962) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 5-methoxy-3-methyl-N-[2-methyl-3-[methyl-(5-oxopyrrolidine-3-carbonyl)amino]propyl]-1H-indole-2-carboxamide.
| Compound Name | 5-methoxy-3-methyl-N-[2-methyl-3-[methyl-(5-oxopyrrolidine-3-carbonyl)amino]propyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166396962 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 5-methoxy-3-methyl-N-[2-methyl-3-[methyl-(5-oxopyrrolidine-3-carbonyl)amino]propyl]-1H-indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c(C(=O)NCC(C)CN(C)C(=O)C3CNC(=O)C3)c(C)c2c1 |
| InChI | InChI=1S/C21H28N4O4/c1-12(11-25(3)21(28)14-7-18(26)22-10-14)9-23-20(27)19-13(2)16-8-15(29-4)5-6-17(16)24-19/h5-6,8,12,14,24H,7,9-11H2,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | BJRLEMFOENQQCF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|