C19H23NO2S — CID 166397351
1-[1-(3,5-dimethylphenyl)ethylsulfonyl]-2-phenylazetidine (PubChem CID 166397351) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is 1-[1-(3,5-dimethylphenyl)ethylsulfonyl]-2-phenylazetidine.
| Compound Name | 1-[1-(3,5-dimethylphenyl)ethylsulfonyl]-2-phenylazetidine |
|---|---|
| PubChem CID | 166397351 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-[1-(3,5-dimethylphenyl)ethylsulfonyl]-2-phenylazetidine |
| SMILES | Cc1cc(C)cc(C(C)S(=O)(=O)N2CCC2c2ccccc2)c1 |
| InChI | InChI=1S/C19H23NO2S/c1-14-11-15(2)13-18(12-14)16(3)23(21,22)20-10-9-19(20)17-7-5-4-6-8-17/h4-8,11-13,16,19H,9-10H2,1-3H3 |
| InChIKey | OYZYMJOFDRAANR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |