C13H16N4O3 — CID 166398464
[1-(2-methyl-4H-furo[3,2-b]pyrrole-5-carbonyl)pyrrolidin-3-yl]urea (PubChem CID 166398464) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is [1-(2-methyl-4H-furo[3,2-b]pyrrole-5-carbonyl)pyrrolidin-3-yl]urea.
| Compound Name | [1-(2-methyl-4H-furo[3,2-b]pyrrole-5-carbonyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 166398464 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | [1-(2-methyl-4H-furo[3,2-b]pyrrole-5-carbonyl)pyrrolidin-3-yl]urea |
| SMILES | Cc1cc2[nH]c(C(=O)N3CCC(NC(N)=O)C3)cc2o1 |
| InChI | InChI=1S/C13H16N4O3/c1-7-4-9-11(20-7)5-10(16-9)12(18)17-3-2-8(6-17)15-13(14)19/h4-5,8,16H,2-3,6H2,1H3,(H3,14,15,19) |
| InChIKey | HPEPUCVVUWYHPU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |