C20H27N3O2 — CID 166401060
(E)-4-methyl-1-[2-(3-pyrrol-1-ylbutanoyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]pent-2-en-1-one (PubChem CID 166401060) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is (E)-4-methyl-1-[2-(3-pyrrol-1-ylbutanoyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]pent-2-en-1-one.
| Compound Name | (E)-4-methyl-1-[2-(3-pyrrol-1-ylbutanoyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]pent-2-en-1-one |
|---|---|
| PubChem CID | 166401060 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (E)-4-methyl-1-[2-(3-pyrrol-1-ylbutanoyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]pent-2-en-1-one |
| SMILES | CC(C)/C=C/C(=O)N1CC2=C(C1)CN(C(=O)CC(C)n1cccc1)C2 |
| InChI | InChI=1S/C20H27N3O2/c1-15(2)6-7-19(24)22-11-17-13-23(14-18(17)12-22)20(25)10-16(3)21-8-4-5-9-21/h4-9,15-16H,10-14H2,1-3H3/b7-6+ |
| InChIKey | VEMQNMAVZCEILP-VOTSOKGWSA-N |
| XLogP | 2.63 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|