About 1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid
1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid (PubChem CID 166402578) has the molecular formula C25H27N5O3
and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid |
| PubChem CID | 166402578 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2ccccc2n1Cc1cn(CC2CN(Cc3ccccc3)CCCO2)nn1 |
| InChI | InChI=1S/C25H27N5O3/c31-25(32)24-13-20-9-4-5-10-23(20)30(24)16-21-15-29(27-26-21)18-22-17-28(11-6-12-33-22)14-19-7-2-1-3-8-19/h1-5,7-10,13,15,22H,6,11-12,14,16-18H2,(H,31,32) |
| InChIKey | OWKFDOCEBGAIOH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid?
The IUPAC name of 1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid (CID 166402578) is 1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid.
What is the SMILES notation for 1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid?
The canonical SMILES for 1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid is O=C(O)c1cc2ccccc2n1Cc1cn(CC2CN(Cc3ccccc3)CCCO2)nn1.
What is the InChIKey of 1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid?
The InChIKey is OWKFDOCEBGAIOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N5O3/c31-25(32)24-13-20-9-4-5-10-23(20)30(24)16-21-15-29(27-26-21)18-22-17-28(11-6-12-33-22)14-19-7-2-1-3-8-19/h1-5,7-10,13,15,22H,6,11-12,14,16-18H2,(H,31,32).
What are the key properties of 1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid?
1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid has a molecular weight of 445.52 g/mol, XLogP of 3.27, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-[(4-benzyl-1,4-oxazepan-2-yl)methyl]triazol-4-yl]methyl]indole-2-carboxylic acid is sourced from PubChem (CID 166402578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).