C17H24IN3OS — CID 16640351
2-[(1-methylpiperidin-1-ium-1-yl)methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one iodide (PubChem CID 16640351) has the molecular formula C17H24IN3OS and a molecular weight of 445.37 g/mol. Its IUPAC name is 2-[(1-methylpiperidin-1-ium-1-yl)methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one iodide.
| Compound Name | 2-[(1-methylpiperidin-1-ium-1-yl)methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one iodide |
|---|---|
| PubChem CID | 16640351 |
| Molecular Formula | C17H24IN3OS |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 2-[(1-methylpiperidin-1-ium-1-yl)methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one iodide |
| SMILES | C[N+]1(Cc2nc3sc4c(c3c(=O)[nH]2)CCCC4)CCCCC1.[I-] |
| InChI | InChI=1S/C17H23N3OS.HI/c1-20(9-5-2-6-10-20)11-14-18-16(21)15-12-7-3-4-8-13(12)22-17(15)19-14;/h2-11H2,1H3;1H |
| InChIKey | LDGMXNWPPUGPFN-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|