C16H18F2N2O2 — CID 166405390
N-(3,3-difluorocyclohexyl)-4-(prop-2-enoylamino)benzamide (PubChem CID 166405390) has the molecular formula C16H18F2N2O2 and a molecular weight of 308.33 g/mol. Its IUPAC name is N-(3,3-difluorocyclohexyl)-4-(prop-2-enoylamino)benzamide.
| Compound Name | N-(3,3-difluorocyclohexyl)-4-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 166405390 |
| Molecular Formula | C16H18F2N2O2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-(3,3-difluorocyclohexyl)-4-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)NC2CCCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C16H18F2N2O2/c1-2-14(21)19-12-7-5-11(6-8-12)15(22)20-13-4-3-9-16(17,18)10-13/h2,5-8,13H,1,3-4,9-10H2,(H,19,21)(H,20,22) |
| InChIKey | VBYDBQRIGKAZMF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|