C18H22N2O4S — CID 166407925
N-(5,5-dioxo-5λ6-thiaspiro[3.5]nonan-8-yl)-3-(prop-2-enoylamino)benzamide (PubChem CID 166407925) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-(5,5-dioxo-5λ6-thiaspiro[3.5]nonan-8-yl)-3-(prop-2-enoylamino)benzamide.
| Compound Name | N-(5,5-dioxo-5λ6-thiaspiro[3.5]nonan-8-yl)-3-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 166407925 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-(5,5-dioxo-5λ6-thiaspiro[3.5]nonan-8-yl)-3-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1cccc(C(=O)NC2CCS(=O)(=O)C3(CCC3)C2)c1 |
| InChI | InChI=1S/C18H22N2O4S/c1-2-16(21)19-14-6-3-5-13(11-14)17(22)20-15-7-10-25(23,24)18(12-15)8-4-9-18/h2-3,5-6,11,15H,1,4,7-10,12H2,(H,19,21)(H,20,22) |
| InChIKey | OVUMLXCGCSTEKN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|