C10H9BrClNO — CID 166407084
1-(5-bromo-1,3-dihydroisoindol-2-yl)-2-chloroethanone (PubChem CID 166407084) has the molecular formula C10H9BrClNO and a molecular weight of 274.55 g/mol. Its IUPAC name is 1-(5-bromo-1,3-dihydroisoindol-2-yl)-2-chloroethanone.
| Compound Name | 1-(5-bromo-1,3-dihydroisoindol-2-yl)-2-chloroethanone |
|---|---|
| PubChem CID | 166407084 |
| Molecular Formula | C10H9BrClNO |
| Molecular Weight | 274.55 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | 1-(5-bromo-1,3-dihydroisoindol-2-yl)-2-chloroethanone |
| SMILES | O=C(CCl)N1Cc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C10H9BrClNO/c11-9-2-1-7-5-13(10(14)4-12)6-8(7)3-9/h1-3H,4-6H2 |
| InChIKey | QHNXKTOCLZGRNX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|