C21H24N4O2 — CID 166407384
N-[3-(2-tert-butyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carbonyl)phenyl]prop-2-enamide (PubChem CID 166407384) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[3-(2-tert-butyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carbonyl)phenyl]prop-2-enamide.
| Compound Name | N-[3-(2-tert-butyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166407384 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | N-[3-(2-tert-butyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carbonyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(C(=O)N2CCc3nc(C(C)(C)C)ncc3C2)c1 |
| InChI | InChI=1S/C21H24N4O2/c1-5-18(26)23-16-8-6-7-14(11-16)19(27)25-10-9-17-15(13-25)12-22-20(24-17)21(2,3)4/h5-8,11-12H,1,9-10,13H2,2-4H3,(H,23,26) |
| InChIKey | FDEDHSMVLVERJG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|