C20H18N2O4 — CID 166420450
methyl 2-[3-(prop-2-enoylamino)benzoyl]-1,3-dihydroisoindole-4-carboxylate (PubChem CID 166420450) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is methyl 2-[3-(prop-2-enoylamino)benzoyl]-1,3-dihydroisoindole-4-carboxylate.
| Compound Name | methyl 2-[3-(prop-2-enoylamino)benzoyl]-1,3-dihydroisoindole-4-carboxylate |
|---|---|
| PubChem CID | 166420450 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | methyl 2-[3-(prop-2-enoylamino)benzoyl]-1,3-dihydroisoindole-4-carboxylate |
| SMILES | C=CC(=O)Nc1cccc(C(=O)N2Cc3cccc(C(=O)OC)c3C2)c1 |
| InChI | InChI=1S/C20H18N2O4/c1-3-18(23)21-15-8-4-6-13(10-15)19(24)22-11-14-7-5-9-16(17(14)12-22)20(25)26-2/h3-10H,1,11-12H2,2H3,(H,21,23) |
| InChIKey | CKVTZAPHYQNKOC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|