C16H16F3N3O4 — CID 166408662
2-hydroxy-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-5-(prop-2-enoylamino)benzamide (PubChem CID 166408662) has the molecular formula C16H16F3N3O4 and a molecular weight of 371.32 g/mol. Its IUPAC name is 2-hydroxy-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-5-(prop-2-enoylamino)benzamide.
| Compound Name | 2-hydroxy-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-5-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 166408662 |
| Molecular Formula | C16H16F3N3O4 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-hydroxy-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-5-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1ccc(O)c(C(=O)NC2CCN(CC(F)(F)F)C2=O)c1 |
| InChI | InChI=1S/C16H16F3N3O4/c1-2-13(24)20-9-3-4-12(23)10(7-9)14(25)21-11-5-6-22(15(11)26)8-16(17,18)19/h2-4,7,11,23H,1,5-6,8H2,(H,20,24)(H,21,25) |
| InChIKey | JTHWJXZGAUQHGS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|