C25H24N4O5 — CID 166409693
N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-1-methyl-2-oxo-3,4-dihydroquinoline-4-carboxamide (PubChem CID 166409693) has the molecular formula C25H24N4O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-1-methyl-2-oxo-3,4-dihydroquinoline-4-carboxamide.
| Compound Name | N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-1-methyl-2-oxo-3,4-dihydroquinoline-4-carboxamide |
|---|---|
| PubChem CID | 166409693 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]-1-methyl-2-oxo-3,4-dihydroquinoline-4-carboxamide |
| SMILES | CN1C(=O)CC(C(=O)NCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)c2ccccc21 |
| InChI | InChI=1S/C25H24N4O5/c1-28-19-5-3-2-4-16(19)18(11-22(28)31)23(32)26-12-14-6-7-15-13-29(25(34)17(15)10-14)20-8-9-21(30)27-24(20)33/h2-7,10,18,20H,8-9,11-13H2,1H3,(H,26,32)(H,27,30,33) |
| InChIKey | FDUWJBJLYSOVRL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|