C20H21F2N3O5 — CID 170268583
(2,2-difluorocyclobutyl)methyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate (PubChem CID 170268583) has the molecular formula C20H21F2N3O5 and a molecular weight of 421.40 g/mol. Its IUPAC name is (2,2-difluorocyclobutyl)methyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate.
| Compound Name | (2,2-difluorocyclobutyl)methyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 170268583 |
| Molecular Formula | C20H21F2N3O5 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | (2,2-difluorocyclobutyl)methyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate |
| SMILES | O=C1CCC(N2Cc3ccc(CNC(=O)OCC4CCC4(F)F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H21F2N3O5/c21-20(22)6-5-13(20)10-30-19(29)23-8-11-1-2-12-9-25(18(28)14(12)7-11)15-3-4-16(26)24-17(15)27/h1-2,7,13,15H,3-6,8-10H2,(H,23,29)(H,24,26,27) |
| InChIKey | UMGJSFSSLJVUSD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|