C23H24N4O6 — CID 176717914
4,5,6,7-tetrahydro-2,1-benzoxazol-3-ylmethyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate (PubChem CID 176717914) has the molecular formula C23H24N4O6 and a molecular weight of 452.47 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-2,1-benzoxazol-3-ylmethyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate.
| Compound Name | 4,5,6,7-tetrahydro-2,1-benzoxazol-3-ylmethyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 176717914 |
| Molecular Formula | C23H24N4O6 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 4,5,6,7-tetrahydro-2,1-benzoxazol-3-ylmethyl N-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl]carbamate |
| SMILES | O=C1CCC(N2Cc3ccc(CNC(=O)OCc4onc5c4CCCC5)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H24N4O6/c28-20-8-7-18(21(29)25-20)27-11-14-6-5-13(9-16(14)22(27)30)10-24-23(31)32-12-19-15-3-1-2-4-17(15)26-33-19/h5-6,9,18H,1-4,7-8,10-12H2,(H,24,31)(H,25,28,29) |
| InChIKey | VARBPNREAXCAOR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|