C18H20F3N3O3 — CID 166410618
3,3,3-trifluoro-N-[(3S)-1-[3-(prop-2-enoylamino)benzoyl]piperidin-3-yl]propanamide (PubChem CID 166410618) has the molecular formula C18H20F3N3O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[(3S)-1-[3-(prop-2-enoylamino)benzoyl]piperidin-3-yl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[(3S)-1-[3-(prop-2-enoylamino)benzoyl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 166410618 |
| Molecular Formula | C18H20F3N3O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 3,3,3-trifluoro-N-[(3S)-1-[3-(prop-2-enoylamino)benzoyl]piperidin-3-yl]propanamide |
| SMILES | C=CC(=O)Nc1cccc(C(=O)N2CCC[C@H](NC(=O)CC(F)(F)F)C2)c1 |
| InChI | InChI=1S/C18H20F3N3O3/c1-2-15(25)22-13-6-3-5-12(9-13)17(27)24-8-4-7-14(11-24)23-16(26)10-18(19,20)21/h2-3,5-6,9,14H,1,4,7-8,10-11H2,(H,22,25)(H,23,26)/t14-/m0/s1 |
| InChIKey | FFKIBQCIKNMGDA-AWEZNQCLSA-N |
| XLogP | 2.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|