C18H16ClFN2O4 — CID 166412408
N-[2-(3-chloro-4-fluorophenoxy)ethyl]-2-hydroxy-5-(prop-2-enoylamino)benzamide (PubChem CID 166412408) has the molecular formula C18H16ClFN2O4 and a molecular weight of 378.79 g/mol. Its IUPAC name is N-[2-(3-chloro-4-fluorophenoxy)ethyl]-2-hydroxy-5-(prop-2-enoylamino)benzamide.
| Compound Name | N-[2-(3-chloro-4-fluorophenoxy)ethyl]-2-hydroxy-5-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 166412408 |
| Molecular Formula | C18H16ClFN2O4 |
| Molecular Weight | 378.79 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-[2-(3-chloro-4-fluorophenoxy)ethyl]-2-hydroxy-5-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1ccc(O)c(C(=O)NCCOc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H16ClFN2O4/c1-2-17(24)22-11-3-6-16(23)13(9-11)18(25)21-7-8-26-12-4-5-15(20)14(19)10-12/h2-6,9-10,23H,1,7-8H2,(H,21,25)(H,22,24) |
| InChIKey | NPKGOYSBFQURNS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|