C20H19N3O5 — CID 166412623
2-hydroxy-N-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)ethyl]-5-(prop-2-enoylamino)benzamide (PubChem CID 166412623) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is 2-hydroxy-N-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)ethyl]-5-(prop-2-enoylamino)benzamide.
| Compound Name | 2-hydroxy-N-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)ethyl]-5-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 166412623 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-hydroxy-N-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)ethyl]-5-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1ccc(O)c(C(=O)NCCC2(O)C(=O)Nc3ccccc32)c1 |
| InChI | InChI=1S/C20H19N3O5/c1-2-17(25)22-12-7-8-16(24)13(11-12)18(26)21-10-9-20(28)14-5-3-4-6-15(14)23-19(20)27/h2-8,11,24,28H,1,9-10H2,(H,21,26)(H,22,25)(H,23,27) |
| InChIKey | OZFFTBDEFJGPLT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|