C17H17N3O2S — CID 166413228
1-prop-2-enoyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 166413228) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-prop-2-enoyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | 1-prop-2-enoyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 166413228 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 1-prop-2-enoyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | C=CC(=O)N1CCCc2cc(C(=O)NCc3cscn3)ccc21 |
| InChI | InChI=1S/C17H17N3O2S/c1-2-16(21)20-7-3-4-12-8-13(5-6-15(12)20)17(22)18-9-14-10-23-11-19-14/h2,5-6,8,10-11H,1,3-4,7,9H2,(H,18,22) |
| InChIKey | ZGKQLZWGGSVVDW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|