C20H20N4O3 — CID 166413301
1-phenyl-3-[(1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carbonyl)amino]urea (PubChem CID 166413301) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-phenyl-3-[(1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carbonyl)amino]urea.
| Compound Name | 1-phenyl-3-[(1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carbonyl)amino]urea |
|---|---|
| PubChem CID | 166413301 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-phenyl-3-[(1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carbonyl)amino]urea |
| SMILES | C=CC(=O)N1CCCc2cc(C(=O)NNC(=O)Nc3ccccc3)ccc21 |
| InChI | InChI=1S/C20H20N4O3/c1-2-18(25)24-12-6-7-14-13-15(10-11-17(14)24)19(26)22-23-20(27)21-16-8-4-3-5-9-16/h2-5,8-11,13H,1,6-7,12H2,(H,22,26)(H2,21,23,27) |
| InChIKey | LMWHDXVFRZHEHC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|