C25H30N2O2 — CID 166413233
N-(2-ethyl-2-phenylbutyl)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 166413233) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-(2-ethyl-2-phenylbutyl)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | N-(2-ethyl-2-phenylbutyl)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 166413233 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-(2-ethyl-2-phenylbutyl)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | C=CC(=O)N1CCCc2cc(C(=O)NCC(CC)(CC)c3ccccc3)ccc21 |
| InChI | InChI=1S/C25H30N2O2/c1-4-23(28)27-16-10-11-19-17-20(14-15-22(19)27)24(29)26-18-25(5-2,6-3)21-12-8-7-9-13-21/h4,7-9,12-15,17H,1,5-6,10-11,16,18H2,2-3H3,(H,26,29) |
| InChIKey | VBJVCQLSLDOJAY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|