C20H24N2O4 — CID 166413264
methyl (3S)-1-(1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carbonyl)piperidine-3-carboxylate (PubChem CID 166413264) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is methyl (3S)-1-(1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carbonyl)piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-(1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 166413264 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | methyl (3S)-1-(1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carbonyl)piperidine-3-carboxylate |
| SMILES | C=CC(=O)N1CCCc2cc(C(=O)N3CCC[C@H](C(=O)OC)C3)ccc21 |
| InChI | InChI=1S/C20H24N2O4/c1-3-18(23)22-11-5-6-14-12-15(8-9-17(14)22)19(24)21-10-4-7-16(13-21)20(25)26-2/h3,8-9,12,16H,1,4-7,10-11,13H2,2H3/t16-/m0/s1 |
| InChIKey | IAFGTZQZYHKLPQ-INIZCTEOSA-N |
| XLogP | 2.18 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|