C21H29N3O4S — CID 166413318
1-[6-(1,1-dioxo-1λ6-thia-2,9-diazacycloundecane-9-carbonyl)-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one (PubChem CID 166413318) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is 1-[6-(1,1-dioxo-1λ6-thia-2,9-diazacycloundecane-9-carbonyl)-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[6-(1,1-dioxo-1λ6-thia-2,9-diazacycloundecane-9-carbonyl)-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166413318 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 1-[6-(1,1-dioxo-1λ6-thia-2,9-diazacycloundecane-9-carbonyl)-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCc2cc(C(=O)N3CCCCCCNS(=O)(=O)CC3)ccc21 |
| InChI | InChI=1S/C21H29N3O4S/c1-2-20(25)24-13-7-8-17-16-18(9-10-19(17)24)21(26)23-12-6-4-3-5-11-22-29(27,28)15-14-23/h2,9-10,16,22H,1,3-8,11-15H2 |
| InChIKey | BUCGUMHSHAZXSC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|