C23H22Cl2N2O3 — CID 154856763
1-[6-[2-(3,4-dichlorophenyl)morpholine-4-carbonyl]-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one (PubChem CID 154856763) has the molecular formula C23H22Cl2N2O3 and a molecular weight of 445.35 g/mol. Its IUPAC name is 1-[6-[2-(3,4-dichlorophenyl)morpholine-4-carbonyl]-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[6-[2-(3,4-dichlorophenyl)morpholine-4-carbonyl]-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 154856763 |
| Molecular Formula | C23H22Cl2N2O3 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1-[6-[2-(3,4-dichlorophenyl)morpholine-4-carbonyl]-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCc2cc(C(=O)N3CCOC(c4ccc(Cl)c(Cl)c4)C3)ccc21 |
| InChI | InChI=1S/C23H22Cl2N2O3/c1-2-22(28)27-9-3-4-15-12-17(6-8-20(15)27)23(29)26-10-11-30-21(14-26)16-5-7-18(24)19(25)13-16/h2,5-8,12-13,21H,1,3-4,9-11,14H2 |
| InChIKey | PNQVJAGUBZEQME-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|