C18H23N3O3 — CID 166414273
4-hydroxy-3-(prop-2-enoylamino)-N-(3-pyrrolidin-1-ylcyclobutyl)benzamide (PubChem CID 166414273) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-hydroxy-3-(prop-2-enoylamino)-N-(3-pyrrolidin-1-ylcyclobutyl)benzamide.
| Compound Name | 4-hydroxy-3-(prop-2-enoylamino)-N-(3-pyrrolidin-1-ylcyclobutyl)benzamide |
|---|---|
| PubChem CID | 166414273 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-hydroxy-3-(prop-2-enoylamino)-N-(3-pyrrolidin-1-ylcyclobutyl)benzamide |
| SMILES | C=CC(=O)Nc1cc(C(=O)NC2CC(N3CCCC3)C2)ccc1O |
| InChI | InChI=1S/C18H23N3O3/c1-2-17(23)20-15-9-12(5-6-16(15)22)18(24)19-13-10-14(11-13)21-7-3-4-8-21/h2,5-6,9,13-14,22H,1,3-4,7-8,10-11H2,(H,19,24)(H,20,23) |
| InChIKey | DBVQKSYETRAPPT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|