C18H13F3N4O3 — CID 167795076
4-hydroxy-3-(prop-2-enoylamino)-N-[4-(trifluoromethyl)-1H-indazol-6-yl]benzamide (PubChem CID 167795076) has the molecular formula C18H13F3N4O3 and a molecular weight of 390.32 g/mol. Its IUPAC name is 4-hydroxy-3-(prop-2-enoylamino)-N-[4-(trifluoromethyl)-1H-indazol-6-yl]benzamide.
| Compound Name | 4-hydroxy-3-(prop-2-enoylamino)-N-[4-(trifluoromethyl)-1H-indazol-6-yl]benzamide |
|---|---|
| PubChem CID | 167795076 |
| Molecular Formula | C18H13F3N4O3 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 4-hydroxy-3-(prop-2-enoylamino)-N-[4-(trifluoromethyl)-1H-indazol-6-yl]benzamide |
| SMILES | C=CC(=O)Nc1cc(C(=O)Nc2cc(C(F)(F)F)c3cn[nH]c3c2)ccc1O |
| InChI | InChI=1S/C18H13F3N4O3/c1-2-16(27)24-14-5-9(3-4-15(14)26)17(28)23-10-6-12(18(19,20)21)11-8-22-25-13(11)7-10/h2-8,26H,1H2,(H,22,25)(H,23,28)(H,24,27) |
| InChIKey | OPHACEOXLKMOOW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|