C11H11BrFNO2 — CID 166414364
N-[(2R)-2-(3-bromo-4-fluorophenyl)-2-hydroxyethyl]prop-2-enamide (PubChem CID 166414364) has the molecular formula C11H11BrFNO2 and a molecular weight of 288.12 g/mol. Its IUPAC name is N-[(2R)-2-(3-bromo-4-fluorophenyl)-2-hydroxyethyl]prop-2-enamide.
| Compound Name | N-[(2R)-2-(3-bromo-4-fluorophenyl)-2-hydroxyethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166414364 |
| Molecular Formula | C11H11BrFNO2 |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | N-[(2R)-2-(3-bromo-4-fluorophenyl)-2-hydroxyethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC[C@H](O)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H11BrFNO2/c1-2-11(16)14-6-10(15)7-3-4-9(13)8(12)5-7/h2-5,10,15H,1,6H2,(H,14,16)/t10-/m0/s1 |
| InChIKey | BVUPXJKSJLMBFE-JTQLQIEISA-N |
| XLogP | 1.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|