C19H28N2O3 — CID 166420233
N-[4-[2-[(1-hydroxy-4,4-dimethylpentan-2-yl)-methylamino]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 166420233) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N-[4-[2-[(1-hydroxy-4,4-dimethylpentan-2-yl)-methylamino]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[2-[(1-hydroxy-4,4-dimethylpentan-2-yl)-methylamino]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166420233 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-[4-[2-[(1-hydroxy-4,4-dimethylpentan-2-yl)-methylamino]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CC(=O)N(C)C(CO)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H28N2O3/c1-6-17(23)20-15-9-7-14(8-10-15)11-18(24)21(5)16(13-22)12-19(2,3)4/h6-10,16,22H,1,11-13H2,2-5H3,(H,20,23) |
| InChIKey | YUNJJSNPVBWJPB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|