C27H44N2O2 — CID 166427310
N-[4-[2-(dioctylamino)-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 166427310) has the molecular formula C27H44N2O2 and a molecular weight of 428.66 g/mol. Its IUPAC name is N-[4-[2-(dioctylamino)-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[2-(dioctylamino)-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166427310 |
| Molecular Formula | C27H44N2O2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.34 |
| IUPAC Name | N-[4-[2-(dioctylamino)-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CC(=O)N(CCCCCCCC)CCCCCCCC)cc1 |
| InChI | InChI=1S/C27H44N2O2/c1-4-7-9-11-13-15-21-29(22-16-14-12-10-8-5-2)27(31)23-24-17-19-25(20-18-24)28-26(30)6-3/h6,17-20H,3-5,7-16,21-23H2,1-2H3,(H,28,30) |
| InChIKey | FFCCATUWWJFNGF-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|