C18H24N4O3 — CID 166420235
N-[4-[2-[2-(cyclohexylcarbamoyl)hydrazinyl]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 166420235) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[4-[2-[2-(cyclohexylcarbamoyl)hydrazinyl]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[2-[2-(cyclohexylcarbamoyl)hydrazinyl]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166420235 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-[4-[2-[2-(cyclohexylcarbamoyl)hydrazinyl]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CC(=O)NNC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H24N4O3/c1-2-16(23)19-15-10-8-13(9-11-15)12-17(24)21-22-18(25)20-14-6-4-3-5-7-14/h2,8-11,14H,1,3-7,12H2,(H,19,23)(H,21,24)(H2,20,22,25) |
| InChIKey | UHTZDWRAKLHJSG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|