C16H18ClN3O3 — CID 166420916
N'-[2-(4-chlorophenyl)acetyl]-1-prop-2-enoylpyrrolidine-3-carbohydrazide (PubChem CID 166420916) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)acetyl]-1-prop-2-enoylpyrrolidine-3-carbohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)acetyl]-1-prop-2-enoylpyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 166420916 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N'-[2-(4-chlorophenyl)acetyl]-1-prop-2-enoylpyrrolidine-3-carbohydrazide |
| SMILES | C=CC(=O)N1CCC(C(=O)NNC(=O)Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H18ClN3O3/c1-2-15(22)20-8-7-12(10-20)16(23)19-18-14(21)9-11-3-5-13(17)6-4-11/h2-6,12H,1,7-10H2,(H,18,21)(H,19,23) |
| InChIKey | URYJDURTTRMMRB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|