C23H24N2O2 — CID 166420947
1-prop-2-enoyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)-3,4-dihydro-2H-quinoline-5-carboxamide (PubChem CID 166420947) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-prop-2-enoyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)-3,4-dihydro-2H-quinoline-5-carboxamide.
| Compound Name | 1-prop-2-enoyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)-3,4-dihydro-2H-quinoline-5-carboxamide |
|---|---|
| PubChem CID | 166420947 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1-prop-2-enoyl-N-(1,2,3,4-tetrahydronaphthalen-2-yl)-3,4-dihydro-2H-quinoline-5-carboxamide |
| SMILES | C=CC(=O)N1CCCc2c(C(=O)NC3CCc4ccccc4C3)cccc21 |
| InChI | InChI=1S/C23H24N2O2/c1-2-22(26)25-14-6-10-19-20(9-5-11-21(19)25)23(27)24-18-13-12-16-7-3-4-8-17(16)15-18/h2-5,7-9,11,18H,1,6,10,12-15H2,(H,24,27) |
| InChIKey | JUDWYWOOJORFOT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|