C20H26N2O2 — CID 166421066
1-[5-(3,5-dimethylpiperidine-1-carbonyl)-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one (PubChem CID 166421066) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-[5-(3,5-dimethylpiperidine-1-carbonyl)-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[5-(3,5-dimethylpiperidine-1-carbonyl)-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166421066 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 1-[5-(3,5-dimethylpiperidine-1-carbonyl)-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCc2c(C(=O)N3CC(C)CC(C)C3)cccc21 |
| InChI | InChI=1S/C20H26N2O2/c1-4-19(23)22-10-6-8-16-17(7-5-9-18(16)22)20(24)21-12-14(2)11-15(3)13-21/h4-5,7,9,14-15H,1,6,8,10-13H2,2-3H3 |
| InChIKey | MJXTUQRHKRVITA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|