C17H17N3O2S — CID 166420952
N-(3-methyl-1,3-thiazol-2-ylidene)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-5-carboxamide (PubChem CID 166420952) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-(3-methyl-1,3-thiazol-2-ylidene)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-5-carboxamide.
| Compound Name | N-(3-methyl-1,3-thiazol-2-ylidene)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-5-carboxamide |
|---|---|
| PubChem CID | 166420952 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-(3-methyl-1,3-thiazol-2-ylidene)-1-prop-2-enoyl-3,4-dihydro-2H-quinoline-5-carboxamide |
| SMILES | C=CC(=O)N1CCCc2c(C(=O)/N=c3\sccn3C)cccc21 |
| InChI | InChI=1S/C17H17N3O2S/c1-3-15(21)20-9-5-7-12-13(6-4-8-14(12)20)16(22)18-17-19(2)10-11-23-17/h3-4,6,8,10-11H,1,5,7,9H2,2H3/b18-17- |
| InChIKey | GYIGPKWCDUXQAA-ZCXUNETKSA-N |
| XLogP | 2.29 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|