C24H24F2N2O2 — CID 166421016
1-[5-[2-[(2,3-difluorophenyl)methyl]pyrrolidine-1-carbonyl]-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one (PubChem CID 166421016) has the molecular formula C24H24F2N2O2 and a molecular weight of 410.46 g/mol. Its IUPAC name is 1-[5-[2-[(2,3-difluorophenyl)methyl]pyrrolidine-1-carbonyl]-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[5-[2-[(2,3-difluorophenyl)methyl]pyrrolidine-1-carbonyl]-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166421016 |
| Molecular Formula | C24H24F2N2O2 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[5-[2-[(2,3-difluorophenyl)methyl]pyrrolidine-1-carbonyl]-3,4-dihydro-2H-quinolin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCc2c(C(=O)N3CCCC3Cc3cccc(F)c3F)cccc21 |
| InChI | InChI=1S/C24H24F2N2O2/c1-2-22(29)28-14-6-10-18-19(9-4-12-21(18)28)24(30)27-13-5-8-17(27)15-16-7-3-11-20(25)23(16)26/h2-4,7,9,11-12,17H,1,5-6,8,10,13-15H2 |
| InChIKey | LBYUVBNXRZTTKG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|