C20H24N4O4S — CID 166422230
N-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]-2-[(prop-2-enoylamino)methyl]benzamide (PubChem CID 166422230) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]-2-[(prop-2-enoylamino)methyl]benzamide.
| Compound Name | N-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]-2-[(prop-2-enoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 166422230 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]-2-[(prop-2-enoylamino)methyl]benzamide |
| SMILES | C=CC(=O)NCc1ccccc1C(=O)Nc1c(C)nn(C2CCS(=O)(=O)C2)c1C |
| InChI | InChI=1S/C20H24N4O4S/c1-4-18(25)21-11-15-7-5-6-8-17(15)20(26)22-19-13(2)23-24(14(19)3)16-9-10-29(27,28)12-16/h4-8,16H,1,9-12H2,2-3H3,(H,21,25)(H,22,26) |
| InChIKey | PZPNLYHZCKWLNF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|