C19H22N4O5S — CID 166412424
N-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]-2-hydroxy-5-(prop-2-enoylamino)benzamide (PubChem CID 166412424) has the molecular formula C19H22N4O5S and a molecular weight of 418.48 g/mol. Its IUPAC name is N-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]-2-hydroxy-5-(prop-2-enoylamino)benzamide.
| Compound Name | N-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]-2-hydroxy-5-(prop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 166412424 |
| Molecular Formula | C19H22N4O5S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-[1-(1,1-dioxothiolan-3-yl)-3,5-dimethylpyrazol-4-yl]-2-hydroxy-5-(prop-2-enoylamino)benzamide |
| SMILES | C=CC(=O)Nc1ccc(O)c(C(=O)Nc2c(C)nn(C3CCS(=O)(=O)C3)c2C)c1 |
| InChI | InChI=1S/C19H22N4O5S/c1-4-17(25)20-13-5-6-16(24)15(9-13)19(26)21-18-11(2)22-23(12(18)3)14-7-8-29(27,28)10-14/h4-6,9,14,24H,1,7-8,10H2,2-3H3,(H,20,25)(H,21,26) |
| InChIKey | DMMWGZFFKFWYQJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|