C20H23FN4O4S — CID 166404937
1-(1,1-dioxothiolan-3-yl)-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]-3-propan-2-ylpyrazole-4-carboxamide (PubChem CID 166404937) has the molecular formula C20H23FN4O4S and a molecular weight of 434.49 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]-3-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]-3-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166404937 |
| Molecular Formula | C20H23FN4O4S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]-3-propan-2-ylpyrazole-4-carboxamide |
| SMILES | C=CC(=O)Nc1cc(NC(=O)c2cn(C3CCS(=O)(=O)C3)nc2C(C)C)ccc1F |
| InChI | InChI=1S/C20H23FN4O4S/c1-4-18(26)23-17-9-13(5-6-16(17)21)22-20(27)15-10-25(24-19(15)12(2)3)14-7-8-30(28,29)11-14/h4-6,9-10,12,14H,1,7-8,11H2,2-3H3,(H,22,27)(H,23,26) |
| InChIKey | WIFMQCGBTIIOGT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|