C18H19FN4O2 — CID 166409137
1-cyclopentyl-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]pyrazole-4-carboxamide (PubChem CID 166409137) has the molecular formula C18H19FN4O2 and a molecular weight of 342.37 g/mol. Its IUPAC name is 1-cyclopentyl-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-cyclopentyl-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166409137 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 1-cyclopentyl-N-[4-fluoro-3-(prop-2-enoylamino)phenyl]pyrazole-4-carboxamide |
| SMILES | C=CC(=O)Nc1cc(NC(=O)c2cnn(C3CCCC3)c2)ccc1F |
| InChI | InChI=1S/C18H19FN4O2/c1-2-17(24)22-16-9-13(7-8-15(16)19)21-18(25)12-10-20-23(11-12)14-5-3-4-6-14/h2,7-11,14H,1,3-6H2,(H,21,25)(H,22,24) |
| InChIKey | CWNIVOLVXPFDPJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|