C17H26N4O2 — CID 166424508
3-cyclopentyl-N,1-dimethyl-N-[3-(prop-2-enoylamino)propyl]pyrazole-4-carboxamide (PubChem CID 166424508) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-cyclopentyl-N,1-dimethyl-N-[3-(prop-2-enoylamino)propyl]pyrazole-4-carboxamide.
| Compound Name | 3-cyclopentyl-N,1-dimethyl-N-[3-(prop-2-enoylamino)propyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166424508 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 3-cyclopentyl-N,1-dimethyl-N-[3-(prop-2-enoylamino)propyl]pyrazole-4-carboxamide |
| SMILES | C=CC(=O)NCCCN(C)C(=O)c1cn(C)nc1C1CCCC1 |
| InChI | InChI=1S/C17H26N4O2/c1-4-15(22)18-10-7-11-20(2)17(23)14-12-21(3)19-16(14)13-8-5-6-9-13/h4,12-13H,1,5-11H2,2-3H3,(H,18,22) |
| InChIKey | ONQAQGFKBUGOCI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|