C16H25F3N4O7S3 — CID 166425017
2,2,2-trifluoroacetic acid;3-[2-[2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoylamino]ethyldisulfanyl]propanoic acid (PubChem CID 166425017) has the molecular formula C16H25F3N4O7S3 and a molecular weight of 538.59 g/mol. Its IUPAC name is 2,2,2-trifluoroacetic acid;3-[2-[2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoylamino]ethyldisulfanyl]propanoic acid.
| Compound Name | 2,2,2-trifluoroacetic acid;3-[2-[2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoylamino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166425017 |
| Molecular Formula | C16H25F3N4O7S3 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | 2,2,2-trifluoroacetic acid;3-[2-[2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]propanoylamino]ethyldisulfanyl]propanoic acid |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)NC(C)C(=O)NCCSSCCC(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H24N4O5S3.C2HF3O2/c1-9-13(11(3)18(4)16-9)26(22,23)17-10(2)14(21)15-6-8-25-24-7-5-12(19)20;3-2(4,5)1(6)7/h10,17H,5-8H2,1-4H3,(H,15,21)(H,19,20);(H,6,7) |
| InChIKey | WYPCXKNREXQWAL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 167.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|