C22H19N3O5S2 — CID 166425625
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-7-methyl-1-benzothiophene-2-sulfonamide (PubChem CID 166425625) has the molecular formula C22H19N3O5S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-7-methyl-1-benzothiophene-2-sulfonamide.
| Compound Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-7-methyl-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 166425625 |
| Molecular Formula | C22H19N3O5S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]-7-methyl-1-benzothiophene-2-sulfonamide |
| SMILES | Cc1cccc2cc(S(=O)(=O)Nc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)sc12 |
| InChI | InChI=1S/C22H19N3O5S2/c1-12-4-2-5-13-10-19(31-20(12)13)32(29,30)24-16-7-3-6-14-15(16)11-25(22(14)28)17-8-9-18(26)23-21(17)27/h2-7,10,17,24H,8-9,11H2,1H3,(H,23,26,27) |
| InChIKey | XVBIOHORWWBTDH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|